C46H78O6S2 — CID 151437702
1-(10,10,10-triethoxydecyl)-4-[[[4-(10,10,10-triethoxydecyl)phenyl]methyldisulfanyl]methyl]benzene (PubChem CID 151437702) has the molecular formula C46H78O6S2 and a molecular weight of 791.26 g/mol. Its IUPAC name is 1-(10,10,10-triethoxydecyl)-4-[[[4-(10,10,10-triethoxydecyl)phenyl]methyldisulfanyl]methyl]benzene.
| Compound Name | 1-(10,10,10-triethoxydecyl)-4-[[[4-(10,10,10-triethoxydecyl)phenyl]methyldisulfanyl]methyl]benzene |
|---|---|
| PubChem CID | 151437702 |
| Molecular Formula | C46H78O6S2 |
| Molecular Weight | 791.26 g/mol |
| Exact Mass | 790.52 |
| IUPAC Name | 1-(10,10,10-triethoxydecyl)-4-[[[4-(10,10,10-triethoxydecyl)phenyl]methyldisulfanyl]methyl]benzene |
| SMILES | CCOC(CCCCCCCCCc1ccc(CSSCc2ccc(CCCCCCCCCC(OCC)(OCC)OCC)cc2)cc1)(OCC)OCC |
| InChI | InChI=1S/C46H78O6S2/c1-7-47-45(48-8-2,49-9-3)37-25-21-17-13-15-19-23-27-41-29-33-43(34-30-41)39-53-54-40-44-35-31-42(32-36-44)28-24-20-16-14-18-22-26-38-46(50-10-4,51-11-5)52-12-6/h29-36H,7-28,37-40H2,1-6H3 |
| InChIKey | PDVYPAWJQRIZOJ-UHFFFAOYSA-N |
| XLogP | 13.62 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.26 |
| LogP ≤ 5 | 13.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|