C30H54O4 — CID 150548684
12-[4-(10,10-dihydroxydodecyl)phenyl]dodecane-3,3-diol (PubChem CID 150548684) has the molecular formula C30H54O4 and a molecular weight of 478.76 g/mol. Its IUPAC name is 12-[4-(10,10-dihydroxydodecyl)phenyl]dodecane-3,3-diol.
| Compound Name | 12-[4-(10,10-dihydroxydodecyl)phenyl]dodecane-3,3-diol |
|---|---|
| PubChem CID | 150548684 |
| Molecular Formula | C30H54O4 |
| Molecular Weight | 478.76 g/mol |
| Exact Mass | 478.40 |
| IUPAC Name | 12-[4-(10,10-dihydroxydodecyl)phenyl]dodecane-3,3-diol |
| SMILES | CCC(O)(O)CCCCCCCCCc1ccc(CCCCCCCCCC(O)(O)CC)cc1 |
| InChI | InChI=1S/C30H54O4/c1-3-29(31,32)25-17-13-9-5-7-11-15-19-27-21-23-28(24-22-27)20-16-12-8-6-10-14-18-26-30(33,34)4-2/h21-24,31-34H,3-20,25-26H2,1-2H3 |
| InChIKey | IHKIALCURTVJDA-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.76 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|