C16H24Cl2O — CID 22760127
9-(3,4-dichlorophenyl)-3-methylnonan-3-ol (PubChem CID 22760127) has the molecular formula C16H24Cl2O and a molecular weight of 303.27 g/mol. Its IUPAC name is 9-(3,4-dichlorophenyl)-3-methylnonan-3-ol.
| Compound Name | 9-(3,4-dichlorophenyl)-3-methylnonan-3-ol |
|---|---|
| PubChem CID | 22760127 |
| Molecular Formula | C16H24Cl2O |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 9-(3,4-dichlorophenyl)-3-methylnonan-3-ol |
| SMILES | CCC(C)(O)CCCCCCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H24Cl2O/c1-3-16(2,19)11-7-5-4-6-8-13-9-10-14(17)15(18)12-13/h9-10,12,19H,3-8,11H2,1-2H3 |
| InChIKey | YHDREHSGPPQCMQ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|