C13H19Cl2N — CID 65308866
6-(3,4-dichlorophenyl)-N-methylhexan-1-amine (PubChem CID 65308866) has the molecular formula C13H19Cl2N and a molecular weight of 260.21 g/mol. Its IUPAC name is 6-(3,4-dichlorophenyl)-N-methylhexan-1-amine.
| Compound Name | 6-(3,4-dichlorophenyl)-N-methylhexan-1-amine |
|---|---|
| PubChem CID | 65308866 |
| Molecular Formula | C13H19Cl2N |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 6-(3,4-dichlorophenyl)-N-methylhexan-1-amine |
| SMILES | CNCCCCCCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H19Cl2N/c1-16-9-5-3-2-4-6-11-7-8-12(14)13(15)10-11/h7-8,10,16H,2-6,9H2,1H3 |
| InChIKey | LCMGFXLWBUBQPE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|