4-(4-chlorophenyl)-N-methylbutan-1-amine;molecular hydrogen

C11H18ClN — CID 158339832

IUPAC4-(4-chlorophenyl)-N-methylbutan-1-amine;molecular hydrogen
SMILESCNCCCCc1ccc(Cl)cc1.[H][H]
InChIInChI=1S/C11H16ClN.H2/c1-13-9-3-2-4-10-5-7-11(12)8-6-10;/h5-8,13H,2-4,9H2,1H3;1H
InChIKeyGRAHRNDFXQPLPC-UHFFFAOYSA-N
MW199.73 g/mol
LogP3.13
Rot. Bonds5

About 4-(4-chlorophenyl)-N-methylbutan-1-amine;molecular hydrogen

4-(4-chlorophenyl)-N-methylbutan-1-amine;molecular hydrogen (PubChem CID 158339832) has the molecular formula C11H18ClN and a molecular weight of 199.73 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-methylbutan-1-amine;molecular hydrogen.

Molecular Properties

Compound Name4-(4-chlorophenyl)-N-methylbutan-1-amine;molecular hydrogen
PubChem CID158339832
Molecular FormulaC11H18ClN
Molecular Weight199.73 g/mol
Exact Mass199.11
IUPAC Name4-(4-chlorophenyl)-N-methylbutan-1-amine;molecular hydrogen
SMILESCNCCCCc1ccc(Cl)cc1.[H][H]
InChIInChI=1S/C11H16ClN.H2/c1-13-9-3-2-4-10-5-7-11(12)8-6-10;/h5-8,13H,2-4,9H2,1H3;1H
InChIKeyGRAHRNDFXQPLPC-UHFFFAOYSA-N
XLogP3.13
TPSA12.03 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds5
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.73
LogP ≤ 53.13
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-(4-chlorophenyl)-N-methylbutan-1-amine;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(4-chlorophenyl)-N-methylbutan-1-amine;molecular hydrogen?
The IUPAC name of 4-(4-chlorophenyl)-N-methylbutan-1-amine;molecular hydrogen (CID 158339832) is 4-(4-chlorophenyl)-N-methylbutan-1-amine;molecular hydrogen.
What is the SMILES notation for 4-(4-chlorophenyl)-N-methylbutan-1-amine;molecular hydrogen?
The canonical SMILES for 4-(4-chlorophenyl)-N-methylbutan-1-amine;molecular hydrogen is CNCCCCc1ccc(Cl)cc1.[H][H].
What is the InChIKey of 4-(4-chlorophenyl)-N-methylbutan-1-amine;molecular hydrogen?
The InChIKey is GRAHRNDFXQPLPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16ClN.H2/c1-13-9-3-2-4-10-5-7-11(12)8-6-10;/h5-8,13H,2-4,9H2,1H3;1H.
What are the key properties of 4-(4-chlorophenyl)-N-methylbutan-1-amine;molecular hydrogen?
4-(4-chlorophenyl)-N-methylbutan-1-amine;molecular hydrogen has a molecular weight of 199.73 g/mol, XLogP of 3.13, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chlorophenyl)-N-methylbutan-1-amine;molecular hydrogen is sourced from PubChem (CID 158339832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).