C13H20ClN — CID 65304680
5-(4-chlorophenyl)-N,3-dimethylpentan-1-amine (PubChem CID 65304680) has the molecular formula C13H20ClN and a molecular weight of 225.76 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N,3-dimethylpentan-1-amine.
| Compound Name | 5-(4-chlorophenyl)-N,3-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 65304680 |
| Molecular Formula | C13H20ClN |
| Molecular Weight | 225.76 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 5-(4-chlorophenyl)-N,3-dimethylpentan-1-amine |
| SMILES | CNCCC(C)CCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H20ClN/c1-11(9-10-15-2)3-4-12-5-7-13(14)8-6-12/h5-8,11,15H,3-4,9-10H2,1-2H3 |
| InChIKey | MGVFLXHOSWQCGK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.76 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |