C19H23NO — CID 65304674
5-dibenzofuran-2-yl-N,3-dimethylpentan-1-amine (PubChem CID 65304674) has the molecular formula C19H23NO and a molecular weight of 281.40 g/mol. Its IUPAC name is 5-dibenzofuran-2-yl-N,3-dimethylpentan-1-amine.
| Compound Name | 5-dibenzofuran-2-yl-N,3-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 65304674 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | 5-dibenzofuran-2-yl-N,3-dimethylpentan-1-amine |
| SMILES | CNCCC(C)CCc1ccc2oc3ccccc3c2c1 |
| InChI | InChI=1S/C19H23NO/c1-14(11-12-20-2)7-8-15-9-10-19-17(13-15)16-5-3-4-6-18(16)21-19/h3-6,9-10,13-14,20H,7-8,11-12H2,1-2H3 |
| InChIKey | PPTMRELCORILGL-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |