About 5-(3,4-diethylphenyl)-N,3-dimethylpentan-1-amine
5-(3,4-diethylphenyl)-N,3-dimethylpentan-1-amine (PubChem CID 113319296) has the molecular formula C17H29N
and a molecular weight of 247.43 g/mol. Its IUPAC name is 5-(3,4-diethylphenyl)-N,3-dimethylpentan-1-amine.
Molecular Properties
| Compound Name | 5-(3,4-diethylphenyl)-N,3-dimethylpentan-1-amine |
| PubChem CID | 113319296 |
| Molecular Formula | C17H29N |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | 5-(3,4-diethylphenyl)-N,3-dimethylpentan-1-amine |
| SMILES | CCc1ccc(CCC(C)CCNC)cc1CC |
| InChI | InChI=1S/C17H29N/c1-5-16-10-9-15(13-17(16)6-2)8-7-14(3)11-12-18-4/h9-10,13-14,18H,5-8,11-12H2,1-4H3 |
| InChIKey | GZBLISHJKOPUGS-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(3,4-diethylphenyl)-N,3-dimethylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-diethylphenyl)-N,3-dimethylpentan-1-amine?
The IUPAC name of 5-(3,4-diethylphenyl)-N,3-dimethylpentan-1-amine (CID 113319296) is 5-(3,4-diethylphenyl)-N,3-dimethylpentan-1-amine.
What is the SMILES notation for 5-(3,4-diethylphenyl)-N,3-dimethylpentan-1-amine?
The canonical SMILES for 5-(3,4-diethylphenyl)-N,3-dimethylpentan-1-amine is CCc1ccc(CCC(C)CCNC)cc1CC.
What is the InChIKey of 5-(3,4-diethylphenyl)-N,3-dimethylpentan-1-amine?
The InChIKey is GZBLISHJKOPUGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29N/c1-5-16-10-9-15(13-17(16)6-2)8-7-14(3)11-12-18-4/h9-10,13-14,18H,5-8,11-12H2,1-4H3.
What are the key properties of 5-(3,4-diethylphenyl)-N,3-dimethylpentan-1-amine?
5-(3,4-diethylphenyl)-N,3-dimethylpentan-1-amine has a molecular weight of 247.43 g/mol, XLogP of 3.99, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-diethylphenyl)-N,3-dimethylpentan-1-amine is sourced from PubChem (CID 113319296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).