C19H33NO — CID 115483366
5-(3,4-diethylphenyl)-N-(2-methoxyethyl)-3-methylpentan-1-amine (PubChem CID 115483366) has the molecular formula C19H33NO and a molecular weight of 291.48 g/mol. Its IUPAC name is 5-(3,4-diethylphenyl)-N-(2-methoxyethyl)-3-methylpentan-1-amine.
| Compound Name | 5-(3,4-diethylphenyl)-N-(2-methoxyethyl)-3-methylpentan-1-amine |
|---|---|
| PubChem CID | 115483366 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | 5-(3,4-diethylphenyl)-N-(2-methoxyethyl)-3-methylpentan-1-amine |
| SMILES | CCc1ccc(CCC(C)CCNCCOC)cc1CC |
| InChI | InChI=1S/C19H33NO/c1-5-18-10-9-17(15-19(18)6-2)8-7-16(3)11-12-20-13-14-21-4/h9-10,15-16,20H,5-8,11-14H2,1-4H3 |
| InChIKey | QWVRUUTXQFODHV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|