C15H25NO2 — CID 65304508
5-(3,4-dimethoxyphenyl)-N,3-dimethylpentan-1-amine (PubChem CID 65304508) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-N,3-dimethylpentan-1-amine.
| Compound Name | 5-(3,4-dimethoxyphenyl)-N,3-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 65304508 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-N,3-dimethylpentan-1-amine |
| SMILES | CNCCC(C)CCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C15H25NO2/c1-12(9-10-16-2)5-6-13-7-8-14(17-3)15(11-13)18-4/h7-8,11-12,16H,5-6,9-10H2,1-4H3 |
| InChIKey | JYUKVOXEIUHFOS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |