C15H26N2O2 — CID 139762530
6-(3,4-dimethoxyphenyl)-4-N-methylhexane-1,4-diamine (PubChem CID 139762530) has the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. Its IUPAC name is 6-(3,4-dimethoxyphenyl)-4-N-methylhexane-1,4-diamine.
| Compound Name | 6-(3,4-dimethoxyphenyl)-4-N-methylhexane-1,4-diamine |
|---|---|
| PubChem CID | 139762530 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 6-(3,4-dimethoxyphenyl)-4-N-methylhexane-1,4-diamine |
| SMILES | CNC(CCCN)CCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C15H26N2O2/c1-17-13(5-4-10-16)8-6-12-7-9-14(18-2)15(11-12)19-3/h7,9,11,13,17H,4-6,8,10,16H2,1-3H3 |
| InChIKey | KQJFHSOIVZQZEO-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |