C14H21BrO2 — CID 64506935
4-(3-bromohexyl)-1,2-dimethoxybenzene (PubChem CID 64506935) has the molecular formula C14H21BrO2 and a molecular weight of 301.22 g/mol. Its IUPAC name is 4-(3-bromohexyl)-1,2-dimethoxybenzene.
| Compound Name | 4-(3-bromohexyl)-1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 64506935 |
| Molecular Formula | C14H21BrO2 |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 4-(3-bromohexyl)-1,2-dimethoxybenzene |
| SMILES | CCCC(Br)CCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C14H21BrO2/c1-4-5-12(15)8-6-11-7-9-13(16-2)14(10-11)17-3/h7,9-10,12H,4-6,8H2,1-3H3 |
| InChIKey | YCTFGJYWJAZUME-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|