C15H24O4 — CID 16637893
4-(3,3-diethoxypropyl)-1,2-dimethoxybenzene (PubChem CID 16637893) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is 4-(3,3-diethoxypropyl)-1,2-dimethoxybenzene.
| Compound Name | 4-(3,3-diethoxypropyl)-1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 16637893 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 4-(3,3-diethoxypropyl)-1,2-dimethoxybenzene |
| SMILES | CCOC(CCc1ccc(OC)c(OC)c1)OCC |
| InChI | InChI=1S/C15H24O4/c1-5-18-15(19-6-2)10-8-12-7-9-13(16-3)14(11-12)17-4/h7,9,11,15H,5-6,8,10H2,1-4H3 |
| InChIKey | SPVJRXHUPYXGRX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|