C13H20O4 — CID 79422604
4-(3,4-dimethoxyphenyl)-1-methoxybutan-2-ol (PubChem CID 79422604) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-1-methoxybutan-2-ol.
| Compound Name | 4-(3,4-dimethoxyphenyl)-1-methoxybutan-2-ol |
|---|---|
| PubChem CID | 79422604 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-1-methoxybutan-2-ol |
| SMILES | COCC(O)CCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C13H20O4/c1-15-9-11(14)6-4-10-5-7-12(16-2)13(8-10)17-3/h5,7-8,11,14H,4,6,9H2,1-3H3 |
| InChIKey | CLQATDBBZWQJNP-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |