C14H22O4 — CID 83928894
1-(3,4-dimethoxyphenyl)hexane-3,4-diol (PubChem CID 83928894) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)hexane-3,4-diol.
| Compound Name | 1-(3,4-dimethoxyphenyl)hexane-3,4-diol |
|---|---|
| PubChem CID | 83928894 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)hexane-3,4-diol |
| SMILES | CCC(O)C(O)CCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C14H22O4/c1-4-11(15)12(16)7-5-10-6-8-13(17-2)14(9-10)18-3/h6,8-9,11-12,15-16H,4-5,7H2,1-3H3 |
| InChIKey | SLPFXPMBBNTZNJ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |