C15H24O3 — CID 83926893
5-(4-methoxy-3-propan-2-ylphenyl)pentane-2,3-diol (PubChem CID 83926893) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is 5-(4-methoxy-3-propan-2-ylphenyl)pentane-2,3-diol.
| Compound Name | 5-(4-methoxy-3-propan-2-ylphenyl)pentane-2,3-diol |
|---|---|
| PubChem CID | 83926893 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 5-(4-methoxy-3-propan-2-ylphenyl)pentane-2,3-diol |
| SMILES | COc1ccc(CCC(O)C(C)O)cc1C(C)C |
| InChI | InChI=1S/C15H24O3/c1-10(2)13-9-12(6-8-15(13)18-4)5-7-14(17)11(3)16/h6,8-11,14,16-17H,5,7H2,1-4H3 |
| InChIKey | SLCJMUMUZMIFQH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |