C12H17N3O2 — CID 10561738
4-(3-azidobutyl)-1,2-dimethoxybenzene (PubChem CID 10561738) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 4-(3-azidobutyl)-1,2-dimethoxybenzene.
| Compound Name | 4-(3-azidobutyl)-1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 10561738 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 4-(3-azidobutyl)-1,2-dimethoxybenzene |
| SMILES | COc1ccc(CCC(C)N=[N+]=[N-])cc1OC |
| InChI | InChI=1S/C12H17N3O2/c1-9(14-15-13)4-5-10-6-7-11(16-2)12(8-10)17-3/h6-9H,4-5H2,1-3H3 |
| InChIKey | SHQPMFNYTPWHSD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|