C15H25N — CID 65304462
5-(2,5-dimethylphenyl)-N,3-dimethylpentan-1-amine (PubChem CID 65304462) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is 5-(2,5-dimethylphenyl)-N,3-dimethylpentan-1-amine.
| Compound Name | 5-(2,5-dimethylphenyl)-N,3-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 65304462 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 5-(2,5-dimethylphenyl)-N,3-dimethylpentan-1-amine |
| SMILES | CNCCC(C)CCc1cc(C)ccc1C |
| InChI | InChI=1S/C15H25N/c1-12(9-10-16-4)6-8-15-11-13(2)5-7-14(15)3/h5,7,11-12,16H,6,8-10H2,1-4H3 |
| InChIKey | TYJSFIVBHMYWCI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |