C12H21N — CID 142925583
1-(2,5-dimethylphenyl)-N-methylmethanamine;ethane (PubChem CID 142925583) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-N-methylmethanamine;ethane.
| Compound Name | 1-(2,5-dimethylphenyl)-N-methylmethanamine;ethane |
|---|---|
| PubChem CID | 142925583 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-N-methylmethanamine;ethane |
| SMILES | CC.CNCc1cc(C)ccc1C |
| InChI | InChI=1S/C10H15N.C2H6/c1-8-4-5-9(2)10(6-8)7-11-3;1-2/h4-6,11H,7H2,1-3H3;1-2H3 |
| InChIKey | KCHGPNBTKACHIZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |