C10H17N3 — CID 115260731
1-(2,5-dimethylphenyl)-N-(hydrazinylmethyl)methanamine (PubChem CID 115260731) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-N-(hydrazinylmethyl)methanamine.
| Compound Name | 1-(2,5-dimethylphenyl)-N-(hydrazinylmethyl)methanamine |
|---|---|
| PubChem CID | 115260731 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-N-(hydrazinylmethyl)methanamine |
| SMILES | Cc1ccc(C)c(CNCNN)c1 |
| InChI | InChI=1S/C10H17N3/c1-8-3-4-9(2)10(5-8)6-12-7-13-11/h3-5,12-13H,6-7,11H2,1-2H3 |
| InChIKey | SEAWYOQXSLLCEE-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|