C13H20ClN — CID 106844225
4-chloro-N-[(2,5-dimethylphenyl)methyl]butan-1-amine (PubChem CID 106844225) has the molecular formula C13H20ClN and a molecular weight of 225.76 g/mol. Its IUPAC name is 4-chloro-N-[(2,5-dimethylphenyl)methyl]butan-1-amine.
| Compound Name | 4-chloro-N-[(2,5-dimethylphenyl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 106844225 |
| Molecular Formula | C13H20ClN |
| Molecular Weight | 225.76 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 4-chloro-N-[(2,5-dimethylphenyl)methyl]butan-1-amine |
| SMILES | Cc1ccc(C)c(CNCCCCCl)c1 |
| InChI | InChI=1S/C13H20ClN/c1-11-5-6-12(2)13(9-11)10-15-8-4-3-7-14/h5-6,9,15H,3-4,7-8,10H2,1-2H3 |
| InChIKey | GODHVQNFMIOYKE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.76 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|