C15H24IN — CID 107844719
N-[(2,5-dimethylphenyl)methyl]-6-iodohexan-1-amine (PubChem CID 107844719) has the molecular formula C15H24IN and a molecular weight of 345.27 g/mol. Its IUPAC name is N-[(2,5-dimethylphenyl)methyl]-6-iodohexan-1-amine.
| Compound Name | N-[(2,5-dimethylphenyl)methyl]-6-iodohexan-1-amine |
|---|---|
| PubChem CID | 107844719 |
| Molecular Formula | C15H24IN |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | N-[(2,5-dimethylphenyl)methyl]-6-iodohexan-1-amine |
| SMILES | Cc1ccc(C)c(CNCCCCCCI)c1 |
| InChI | InChI=1S/C15H24IN/c1-13-7-8-14(2)15(11-13)12-17-10-6-4-3-5-9-16/h7-8,11,17H,3-6,9-10,12H2,1-2H3 |
| InChIKey | KKJBDHYGLAQFBR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|