C14H22IN — CID 106844682
4-iodo-N-[(2,4,6-trimethylphenyl)methyl]butan-1-amine (PubChem CID 106844682) has the molecular formula C14H22IN and a molecular weight of 331.24 g/mol. Its IUPAC name is 4-iodo-N-[(2,4,6-trimethylphenyl)methyl]butan-1-amine.
| Compound Name | 4-iodo-N-[(2,4,6-trimethylphenyl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 106844682 |
| Molecular Formula | C14H22IN |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 4-iodo-N-[(2,4,6-trimethylphenyl)methyl]butan-1-amine |
| SMILES | Cc1cc(C)c(CNCCCCI)c(C)c1 |
| InChI | InChI=1S/C14H22IN/c1-11-8-12(2)14(13(3)9-11)10-16-7-5-4-6-15/h8-9,16H,4-7,10H2,1-3H3 |
| InChIKey | LKMNLXMTMRUORC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|