About 3-methylsulfinyl-N-[(2,4,6-trimethylphenyl)methyl]propan-1-amine
3-methylsulfinyl-N-[(2,4,6-trimethylphenyl)methyl]propan-1-amine (PubChem CID 115632922) has the molecular formula C14H23NOS
and a molecular weight of 253.41 g/mol. Its IUPAC name is 3-methylsulfinyl-N-[(2,4,6-trimethylphenyl)methyl]propan-1-amine.
Molecular Properties
| Compound Name | 3-methylsulfinyl-N-[(2,4,6-trimethylphenyl)methyl]propan-1-amine |
| PubChem CID | 115632922 |
| Molecular Formula | C14H23NOS |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 3-methylsulfinyl-N-[(2,4,6-trimethylphenyl)methyl]propan-1-amine |
| SMILES | Cc1cc(C)c(CNCCCS(C)=O)c(C)c1 |
| InChI | InChI=1S/C14H23NOS/c1-11-8-12(2)14(13(3)9-11)10-15-6-5-7-17(4)16/h8-9,15H,5-7,10H2,1-4H3 |
| InChIKey | NHCMGWUMMVFNHP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methylsulfinyl-N-[(2,4,6-trimethylphenyl)methyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylsulfinyl-N-[(2,4,6-trimethylphenyl)methyl]propan-1-amine?
The IUPAC name of 3-methylsulfinyl-N-[(2,4,6-trimethylphenyl)methyl]propan-1-amine (CID 115632922) is 3-methylsulfinyl-N-[(2,4,6-trimethylphenyl)methyl]propan-1-amine.
What is the SMILES notation for 3-methylsulfinyl-N-[(2,4,6-trimethylphenyl)methyl]propan-1-amine?
The canonical SMILES for 3-methylsulfinyl-N-[(2,4,6-trimethylphenyl)methyl]propan-1-amine is Cc1cc(C)c(CNCCCS(C)=O)c(C)c1.
What is the InChIKey of 3-methylsulfinyl-N-[(2,4,6-trimethylphenyl)methyl]propan-1-amine?
The InChIKey is NHCMGWUMMVFNHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23NOS/c1-11-8-12(2)14(13(3)9-11)10-15-6-5-7-17(4)16/h8-9,15H,5-7,10H2,1-4H3.
What are the key properties of 3-methylsulfinyl-N-[(2,4,6-trimethylphenyl)methyl]propan-1-amine?
3-methylsulfinyl-N-[(2,4,6-trimethylphenyl)methyl]propan-1-amine has a molecular weight of 253.41 g/mol, XLogP of 2.47, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylsulfinyl-N-[(2,4,6-trimethylphenyl)methyl]propan-1-amine is sourced from PubChem (CID 115632922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).