C12H19NS — CID 115223927
2-[(2,4,6-trimethylphenyl)methylamino]ethanethiol (PubChem CID 115223927) has the molecular formula C12H19NS and a molecular weight of 209.36 g/mol. Its IUPAC name is 2-[(2,4,6-trimethylphenyl)methylamino]ethanethiol.
| Compound Name | 2-[(2,4,6-trimethylphenyl)methylamino]ethanethiol |
|---|---|
| PubChem CID | 115223927 |
| Molecular Formula | C12H19NS |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 2-[(2,4,6-trimethylphenyl)methylamino]ethanethiol |
| SMILES | Cc1cc(C)c(CNCCS)c(C)c1 |
| InChI | InChI=1S/C12H19NS/c1-9-6-10(2)12(11(3)7-9)8-13-4-5-14/h6-7,13-14H,4-5,8H2,1-3H3 |
| InChIKey | CEITZZLOTRTEOG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|