C13H22N2O — CID 115195883
N'-[(2-methoxy-4,6-dimethylphenyl)methyl]-N-methylethane-1,2-diamine (PubChem CID 115195883) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is N'-[(2-methoxy-4,6-dimethylphenyl)methyl]-N-methylethane-1,2-diamine.
| Compound Name | N'-[(2-methoxy-4,6-dimethylphenyl)methyl]-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 115195883 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | N'-[(2-methoxy-4,6-dimethylphenyl)methyl]-N-methylethane-1,2-diamine |
| SMILES | CNCCNCc1c(C)cc(C)cc1OC |
| InChI | InChI=1S/C13H22N2O/c1-10-7-11(2)12(13(8-10)16-4)9-15-6-5-14-3/h7-8,14-15H,5-6,9H2,1-4H3 |
| InChIKey | GMVODBQGXRQDRY-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|