C11H17NO3S2 — CID 103265008
5-methyl-4-[(3-methylsulfinylpropylamino)methyl]thiophene-2-carboxylic acid (PubChem CID 103265008) has the molecular formula C11H17NO3S2 and a molecular weight of 275.39 g/mol. Its IUPAC name is 5-methyl-4-[(3-methylsulfinylpropylamino)methyl]thiophene-2-carboxylic acid.
| Compound Name | 5-methyl-4-[(3-methylsulfinylpropylamino)methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 103265008 |
| Molecular Formula | C11H17NO3S2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 5-methyl-4-[(3-methylsulfinylpropylamino)methyl]thiophene-2-carboxylic acid |
| SMILES | Cc1sc(C(=O)O)cc1CNCCCS(C)=O |
| InChI | InChI=1S/C11H17NO3S2/c1-8-9(6-10(16-8)11(13)14)7-12-4-3-5-17(2)15/h6,12H,3-5,7H2,1-2H3,(H,13,14) |
| InChIKey | XOWDBCFZBXQVFE-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|