C11H17NO3S — CID 103238034
4-[(1-hydroxybutan-2-ylamino)methyl]-5-methylthiophene-2-carboxylic acid (PubChem CID 103238034) has the molecular formula C11H17NO3S and a molecular weight of 243.33 g/mol. Its IUPAC name is 4-[(1-hydroxybutan-2-ylamino)methyl]-5-methylthiophene-2-carboxylic acid.
| Compound Name | 4-[(1-hydroxybutan-2-ylamino)methyl]-5-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 103238034 |
| Molecular Formula | C11H17NO3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 4-[(1-hydroxybutan-2-ylamino)methyl]-5-methylthiophene-2-carboxylic acid |
| SMILES | CCC(CO)NCc1cc(C(=O)O)sc1C |
| InChI | InChI=1S/C11H17NO3S/c1-3-9(6-13)12-5-8-4-10(11(14)15)16-7(8)2/h4,9,12-13H,3,5-6H2,1-2H3,(H,14,15) |
| InChIKey | HYHHYUFZXVQXPH-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |