C7H9NO3S — CID 103282710
4-[(hydroxyamino)methyl]-5-methylthiophene-2-carboxylic acid (PubChem CID 103282710) has the molecular formula C7H9NO3S and a molecular weight of 187.22 g/mol. Its IUPAC name is 4-[(hydroxyamino)methyl]-5-methylthiophene-2-carboxylic acid.
| Compound Name | 4-[(hydroxyamino)methyl]-5-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 103282710 |
| Molecular Formula | C7H9NO3S |
| Molecular Weight | 187.22 g/mol |
| Exact Mass | 187.03 |
| IUPAC Name | 4-[(hydroxyamino)methyl]-5-methylthiophene-2-carboxylic acid |
| SMILES | Cc1sc(C(=O)O)cc1CNO |
| InChI | InChI=1S/C7H9NO3S/c1-4-5(3-8-11)2-6(12-4)7(9)10/h2,8,11H,3H2,1H3,(H,9,10) |
| InChIKey | AFGNCXKSCXPPRO-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.22 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|