C13H21NO2S — CID 103264443
5-methyl-4-[(2-methylpentan-2-ylamino)methyl]thiophene-2-carboxylic acid (PubChem CID 103264443) has the molecular formula C13H21NO2S and a molecular weight of 255.38 g/mol. Its IUPAC name is 5-methyl-4-[(2-methylpentan-2-ylamino)methyl]thiophene-2-carboxylic acid.
| Compound Name | 5-methyl-4-[(2-methylpentan-2-ylamino)methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 103264443 |
| Molecular Formula | C13H21NO2S |
| Molecular Weight | 255.38 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 5-methyl-4-[(2-methylpentan-2-ylamino)methyl]thiophene-2-carboxylic acid |
| SMILES | CCCC(C)(C)NCc1cc(C(=O)O)sc1C |
| InChI | InChI=1S/C13H21NO2S/c1-5-6-13(3,4)14-8-10-7-11(12(15)16)17-9(10)2/h7,14H,5-6,8H2,1-4H3,(H,15,16) |
| InChIKey | DEOUIVAFBKHBNA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |