C14H17NO2S2 — CID 114136342
4-[[(5-ethylthiophen-2-yl)methylamino]methyl]-5-methylthiophene-2-carboxylic acid (PubChem CID 114136342) has the molecular formula C14H17NO2S2 and a molecular weight of 295.43 g/mol. Its IUPAC name is 4-[[(5-ethylthiophen-2-yl)methylamino]methyl]-5-methylthiophene-2-carboxylic acid.
| Compound Name | 4-[[(5-ethylthiophen-2-yl)methylamino]methyl]-5-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 114136342 |
| Molecular Formula | C14H17NO2S2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 4-[[(5-ethylthiophen-2-yl)methylamino]methyl]-5-methylthiophene-2-carboxylic acid |
| SMILES | CCc1ccc(CNCc2cc(C(=O)O)sc2C)s1 |
| InChI | InChI=1S/C14H17NO2S2/c1-3-11-4-5-12(19-11)8-15-7-10-6-13(14(16)17)18-9(10)2/h4-6,15H,3,7-8H2,1-2H3,(H,16,17) |
| InChIKey | XWHSKYPJGCZLOP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |