C10H13Cl — CID 53403519
2-(2-chloroethyl)-1,4-dimethylbenzene (PubChem CID 53403519) has the molecular formula C10H13Cl and a molecular weight of 168.67 g/mol. Its IUPAC name is 2-(2-chloroethyl)-1,4-dimethylbenzene.
| Compound Name | 2-(2-chloroethyl)-1,4-dimethylbenzene |
|---|---|
| PubChem CID | 53403519 |
| Molecular Formula | C10H13Cl |
| Molecular Weight | 168.67 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | 2-(2-chloroethyl)-1,4-dimethylbenzene |
| SMILES | Cc1ccc(C)c(CCCl)c1 |
| InChI | InChI=1S/C10H13Cl/c1-8-3-4-9(2)10(7-8)5-6-11/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | VYHMCETVHBOXNR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.67 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|