C12H17ClO2S — CID 98702218
4-(2,5-dimethylphenyl)butane-1-sulfonyl chloride (PubChem CID 98702218) has the molecular formula C12H17ClO2S and a molecular weight of 260.79 g/mol. Its IUPAC name is 4-(2,5-dimethylphenyl)butane-1-sulfonyl chloride.
| Compound Name | 4-(2,5-dimethylphenyl)butane-1-sulfonyl chloride |
|---|---|
| PubChem CID | 98702218 |
| Molecular Formula | C12H17ClO2S |
| Molecular Weight | 260.79 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 4-(2,5-dimethylphenyl)butane-1-sulfonyl chloride |
| SMILES | Cc1ccc(C)c(CCCCS(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C12H17ClO2S/c1-10-6-7-11(2)12(9-10)5-3-4-8-16(13,14)15/h6-7,9H,3-5,8H2,1-2H3 |
| InChIKey | FPNYXQGYFDSAMG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.79 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|