C19H26O6S2 — CID 91079290
2-(2,5-dimethylphenyl)ethanesulfonic acid;(2,5-dimethylphenyl)methanesulfonic acid (PubChem CID 91079290) has the molecular formula C19H26O6S2 and a molecular weight of 414.55 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)ethanesulfonic acid;(2,5-dimethylphenyl)methanesulfonic acid.
| Compound Name | 2-(2,5-dimethylphenyl)ethanesulfonic acid;(2,5-dimethylphenyl)methanesulfonic acid |
|---|---|
| PubChem CID | 91079290 |
| Molecular Formula | C19H26O6S2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 2-(2,5-dimethylphenyl)ethanesulfonic acid;(2,5-dimethylphenyl)methanesulfonic acid |
| SMILES | Cc1ccc(C)c(CCS(=O)(=O)O)c1.Cc1ccc(C)c(CS(=O)(=O)O)c1 |
| InChI | InChI=1S/C10H14O3S.C9H12O3S/c1-8-3-4-9(2)10(7-8)5-6-14(11,12)13;1-7-3-4-8(2)9(5-7)6-13(10,11)12/h3-4,7H,5-6H2,1-2H3,(H,11,12,13);3-5H,6H2,1-2H3,(H,10,11,12) |
| InChIKey | PBNUTTUQEPJTSK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|