C11H14O4S — CID 59648740
3-(2,5-dimethylphenyl)-3-oxopropane-1-sulfonic acid (PubChem CID 59648740) has the molecular formula C11H14O4S and a molecular weight of 242.30 g/mol. Its IUPAC name is 3-(2,5-dimethylphenyl)-3-oxopropane-1-sulfonic acid.
| Compound Name | 3-(2,5-dimethylphenyl)-3-oxopropane-1-sulfonic acid |
|---|---|
| PubChem CID | 59648740 |
| Molecular Formula | C11H14O4S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 3-(2,5-dimethylphenyl)-3-oxopropane-1-sulfonic acid |
| SMILES | Cc1ccc(C)c(C(=O)CCS(=O)(=O)O)c1 |
| InChI | InChI=1S/C11H14O4S/c1-8-3-4-9(2)10(7-8)11(12)5-6-16(13,14)15/h3-4,7H,5-6H2,1-2H3,(H,13,14,15) |
| InChIKey | FJACBUFYPUQCOC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|