C18H26N2O4S2 — CID 69226384
(2,5-dimethylphenyl)methanesulfonamide (PubChem CID 69226384) has the molecular formula C18H26N2O4S2 and a molecular weight of 398.55 g/mol. Its IUPAC name is (2,5-dimethylphenyl)methanesulfonamide.
| Compound Name | (2,5-dimethylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 69226384 |
| Molecular Formula | C18H26N2O4S2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | (2,5-dimethylphenyl)methanesulfonamide |
| SMILES | Cc1ccc(C)c(CS(N)(=O)=O)c1.Cc1ccc(C)c(CS(N)(=O)=O)c1 |
| InChI | InChI=1S/2C9H13NO2S/c2*1-7-3-4-8(2)9(5-7)6-13(10,11)12/h2*3-5H,6H2,1-2H3,(H2,10,11,12) |
| InChIKey | PRVOUFAIADVJSL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |