C9H13NO2S — CID 59964487
(2,4-dimethylphenyl)methanesulfonamide (PubChem CID 59964487) has the molecular formula C9H13NO2S and a molecular weight of 199.28 g/mol. Its IUPAC name is (2,4-dimethylphenyl)methanesulfonamide.
| Compound Name | (2,4-dimethylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 59964487 |
| Molecular Formula | C9H13NO2S |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | (2,4-dimethylphenyl)methanesulfonamide |
| SMILES | Cc1ccc(CS(N)(=O)=O)c(C)c1 |
| InChI | InChI=1S/C9H13NO2S/c1-7-3-4-9(8(2)5-7)6-13(10,11)12/h3-5H,6H2,1-2H3,(H2,10,11,12) |
| InChIKey | STMXWWVAWAONFA-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |