C9H14N2O5S2 — CID 123527984
[5-hydroxy-4-(methanesulfonamido)-2-methylphenyl]methanesulfonamide (PubChem CID 123527984) has the molecular formula C9H14N2O5S2 and a molecular weight of 294.35 g/mol. Its IUPAC name is [5-hydroxy-4-(methanesulfonamido)-2-methylphenyl]methanesulfonamide.
| Compound Name | [5-hydroxy-4-(methanesulfonamido)-2-methylphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 123527984 |
| Molecular Formula | C9H14N2O5S2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | [5-hydroxy-4-(methanesulfonamido)-2-methylphenyl]methanesulfonamide |
| SMILES | Cc1cc(NS(C)(=O)=O)c(O)cc1CS(N)(=O)=O |
| InChI | InChI=1S/C9H14N2O5S2/c1-6-3-8(11-17(2,13)14)9(12)4-7(6)5-18(10,15)16/h3-4,11-12H,5H2,1-2H3,(H2,10,15,16) |
| InChIKey | BLOATXNHNVBZDS-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|