C9H14N2O2S — CID 103144685
N-(4-amino-2,5-dimethylphenyl)methanesulfonamide (PubChem CID 103144685) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is N-(4-amino-2,5-dimethylphenyl)methanesulfonamide.
| Compound Name | N-(4-amino-2,5-dimethylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 103144685 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | N-(4-amino-2,5-dimethylphenyl)methanesulfonamide |
| SMILES | Cc1cc(NS(C)(=O)=O)c(C)cc1N |
| InChI | InChI=1S/C9H14N2O2S/c1-6-5-9(11-14(3,12)13)7(2)4-8(6)10/h4-5,11H,10H2,1-3H3 |
| InChIKey | CZIPJTYLBZONJB-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|