C12H19N3O4S — CID 103144752
propan-2-yl N-[(4-amino-2,5-dimethylphenyl)sulfamoyl]carbamate (PubChem CID 103144752) has the molecular formula C12H19N3O4S and a molecular weight of 301.37 g/mol. Its IUPAC name is propan-2-yl N-[(4-amino-2,5-dimethylphenyl)sulfamoyl]carbamate.
| Compound Name | propan-2-yl N-[(4-amino-2,5-dimethylphenyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 103144752 |
| Molecular Formula | C12H19N3O4S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | propan-2-yl N-[(4-amino-2,5-dimethylphenyl)sulfamoyl]carbamate |
| SMILES | Cc1cc(NS(=O)(=O)NC(=O)OC(C)C)c(C)cc1N |
| InChI | InChI=1S/C12H19N3O4S/c1-7(2)19-12(16)15-20(17,18)14-11-6-8(3)10(13)5-9(11)4/h5-7,14H,13H2,1-4H3,(H,15,16) |
| InChIKey | UXXQKCJIDFRRQG-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|