C12H18N2O5S — CID 106954584
propan-2-yl N-[(4-hydroxy-2,5-dimethylphenyl)sulfamoyl]carbamate (PubChem CID 106954584) has the molecular formula C12H18N2O5S and a molecular weight of 302.35 g/mol. Its IUPAC name is propan-2-yl N-[(4-hydroxy-2,5-dimethylphenyl)sulfamoyl]carbamate.
| Compound Name | propan-2-yl N-[(4-hydroxy-2,5-dimethylphenyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 106954584 |
| Molecular Formula | C12H18N2O5S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | propan-2-yl N-[(4-hydroxy-2,5-dimethylphenyl)sulfamoyl]carbamate |
| SMILES | Cc1cc(NS(=O)(=O)NC(=O)OC(C)C)c(C)cc1O |
| InChI | InChI=1S/C12H18N2O5S/c1-7(2)19-12(16)14-20(17,18)13-10-5-9(4)11(15)6-8(10)3/h5-7,13,15H,1-4H3,(H,14,16) |
| InChIKey | XCDZUZIOZQVEIX-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|