C11H12ClN3O4S — CID 114463481
propan-2-yl N-[(2-chloro-5-cyanophenyl)sulfamoyl]carbamate (PubChem CID 114463481) has the molecular formula C11H12ClN3O4S and a molecular weight of 317.75 g/mol. Its IUPAC name is propan-2-yl N-[(2-chloro-5-cyanophenyl)sulfamoyl]carbamate.
| Compound Name | propan-2-yl N-[(2-chloro-5-cyanophenyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 114463481 |
| Molecular Formula | C11H12ClN3O4S |
| Molecular Weight | 317.75 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | propan-2-yl N-[(2-chloro-5-cyanophenyl)sulfamoyl]carbamate |
| SMILES | CC(C)OC(=O)NS(=O)(=O)Nc1cc(C#N)ccc1Cl |
| InChI | InChI=1S/C11H12ClN3O4S/c1-7(2)19-11(16)15-20(17,18)14-10-5-8(6-13)3-4-9(10)12/h3-5,7,14H,1-2H3,(H,15,16) |
| InChIKey | BWWSEEUMCZVOIE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.75 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |