C10H14ClN3O4S — CID 114050687
propan-2-yl N-[(2-chloro-5-methyl-3-pyridinyl)sulfamoyl]carbamate (PubChem CID 114050687) has the molecular formula C10H14ClN3O4S and a molecular weight of 307.76 g/mol. Its IUPAC name is propan-2-yl N-[(2-chloro-5-methyl-3-pyridinyl)sulfamoyl]carbamate.
| Compound Name | propan-2-yl N-[(2-chloro-5-methyl-3-pyridinyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 114050687 |
| Molecular Formula | C10H14ClN3O4S |
| Molecular Weight | 307.76 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | propan-2-yl N-[(2-chloro-5-methyl-3-pyridinyl)sulfamoyl]carbamate |
| SMILES | Cc1cnc(Cl)c(NS(=O)(=O)NC(=O)OC(C)C)c1 |
| InChI | InChI=1S/C10H14ClN3O4S/c1-6(2)18-10(15)14-19(16,17)13-8-4-7(3)5-12-9(8)11/h4-6,13H,1-3H3,(H,14,15) |
| InChIKey | MBVOIDGWMJMJJF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.76 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|