C11H13ClN2O6S — CID 114462676
2-chloro-6-(propan-2-yloxycarbonylsulfamoylamino)benzoic acid (PubChem CID 114462676) has the molecular formula C11H13ClN2O6S and a molecular weight of 336.75 g/mol. Its IUPAC name is 2-chloro-6-(propan-2-yloxycarbonylsulfamoylamino)benzoic acid.
| Compound Name | 2-chloro-6-(propan-2-yloxycarbonylsulfamoylamino)benzoic acid |
|---|---|
| PubChem CID | 114462676 |
| Molecular Formula | C11H13ClN2O6S |
| Molecular Weight | 336.75 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | 2-chloro-6-(propan-2-yloxycarbonylsulfamoylamino)benzoic acid |
| SMILES | CC(C)OC(=O)NS(=O)(=O)Nc1cccc(Cl)c1C(=O)O |
| InChI | InChI=1S/C11H13ClN2O6S/c1-6(2)20-11(17)14-21(18,19)13-8-5-3-4-7(12)9(8)10(15)16/h3-6,13H,1-2H3,(H,14,17)(H,15,16) |
| InChIKey | AFROUQKEUWOTAY-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.75 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |