C11H16FN3O4S — CID 114461222
propan-2-yl N-[[2-(aminomethyl)-3-fluorophenyl]sulfamoyl]carbamate (PubChem CID 114461222) has the molecular formula C11H16FN3O4S and a molecular weight of 305.33 g/mol. Its IUPAC name is propan-2-yl N-[[2-(aminomethyl)-3-fluorophenyl]sulfamoyl]carbamate.
| Compound Name | propan-2-yl N-[[2-(aminomethyl)-3-fluorophenyl]sulfamoyl]carbamate |
|---|---|
| PubChem CID | 114461222 |
| Molecular Formula | C11H16FN3O4S |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | propan-2-yl N-[[2-(aminomethyl)-3-fluorophenyl]sulfamoyl]carbamate |
| SMILES | CC(C)OC(=O)NS(=O)(=O)Nc1cccc(F)c1CN |
| InChI | InChI=1S/C11H16FN3O4S/c1-7(2)19-11(16)15-20(17,18)14-10-5-3-4-9(12)8(10)6-13/h3-5,7,14H,6,13H2,1-2H3,(H,15,16) |
| InChIKey | LXPLPUFVSKAOGO-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |