C11H15FN4O4S — CID 114467559
propan-2-yl N-[(4-carbamimidoyl-2-fluorophenyl)sulfamoyl]carbamate (PubChem CID 114467559) has the molecular formula C11H15FN4O4S and a molecular weight of 318.33 g/mol. Its IUPAC name is propan-2-yl N-[(4-carbamimidoyl-2-fluorophenyl)sulfamoyl]carbamate.
| Compound Name | propan-2-yl N-[(4-carbamimidoyl-2-fluorophenyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 114467559 |
| Molecular Formula | C11H15FN4O4S |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | propan-2-yl N-[(4-carbamimidoyl-2-fluorophenyl)sulfamoyl]carbamate |
| SMILES | [H]/N=C(\N)c1ccc(NS(=O)(=O)NC(=O)OC(C)C)c(F)c1 |
| InChI | InChI=1S/C11H15FN4O4S/c1-6(2)20-11(17)16-21(18,19)15-9-4-3-7(10(13)14)5-8(9)12/h3-6,15H,1-2H3,(H3,13,14)(H,16,17) |
| InChIKey | YBZQPZYRMDXXGH-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 134.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|