C10H13FN4O4S — CID 114467334
ethyl N-[(2-carbamimidoyl-3-fluorophenyl)sulfamoyl]carbamate (PubChem CID 114467334) has the molecular formula C10H13FN4O4S and a molecular weight of 304.30 g/mol. Its IUPAC name is ethyl N-[(2-carbamimidoyl-3-fluorophenyl)sulfamoyl]carbamate.
| Compound Name | ethyl N-[(2-carbamimidoyl-3-fluorophenyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 114467334 |
| Molecular Formula | C10H13FN4O4S |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | ethyl N-[(2-carbamimidoyl-3-fluorophenyl)sulfamoyl]carbamate |
| SMILES | [H]/N=C(\N)c1c(F)cccc1NS(=O)(=O)NC(=O)OCC |
| InChI | InChI=1S/C10H13FN4O4S/c1-2-19-10(16)15-20(17,18)14-7-5-3-4-6(11)8(7)9(12)13/h3-5,14H,2H2,1H3,(H3,12,13)(H,15,16) |
| InChIKey | KURGEVMCRQNVJN-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 134.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|