C13H20FN3O2S — CID 103521962
2-(3,3-dimethylbutylsulfonylamino)-6-fluorobenzenecarboximidamide (PubChem CID 103521962) has the molecular formula C13H20FN3O2S and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-(3,3-dimethylbutylsulfonylamino)-6-fluorobenzenecarboximidamide.
| Compound Name | 2-(3,3-dimethylbutylsulfonylamino)-6-fluorobenzenecarboximidamide |
|---|---|
| PubChem CID | 103521962 |
| Molecular Formula | C13H20FN3O2S |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-(3,3-dimethylbutylsulfonylamino)-6-fluorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1c(F)cccc1NS(=O)(=O)CCC(C)(C)C |
| InChI | InChI=1S/C13H20FN3O2S/c1-13(2,3)7-8-20(18,19)17-10-6-4-5-9(14)11(10)12(15)16/h4-6,17H,7-8H2,1-3H3,(H3,15,16) |
| InChIKey | LFFRDDHLGNMCHB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|