C13H20N2O2S2 — CID 107799135
2-(2,2-dimethylpropylsulfonylamino)-6-methylbenzenecarbothioamide (PubChem CID 107799135) has the molecular formula C13H20N2O2S2 and a molecular weight of 300.45 g/mol. Its IUPAC name is 2-(2,2-dimethylpropylsulfonylamino)-6-methylbenzenecarbothioamide.
| Compound Name | 2-(2,2-dimethylpropylsulfonylamino)-6-methylbenzenecarbothioamide |
|---|---|
| PubChem CID | 107799135 |
| Molecular Formula | C13H20N2O2S2 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 2-(2,2-dimethylpropylsulfonylamino)-6-methylbenzenecarbothioamide |
| SMILES | Cc1cccc(NS(=O)(=O)CC(C)(C)C)c1C(N)=S |
| InChI | InChI=1S/C13H20N2O2S2/c1-9-6-5-7-10(11(9)12(14)18)15-19(16,17)8-13(2,3)4/h5-7,15H,8H2,1-4H3,(H2,14,18) |
| InChIKey | YDHPBMQNWZPHHN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|