C16H24N2OS — CID 107805667
N-(2-carbamothioyl-3-methylphenyl)-3,4,4-trimethylpentanamide (PubChem CID 107805667) has the molecular formula C16H24N2OS and a molecular weight of 292.45 g/mol. Its IUPAC name is N-(2-carbamothioyl-3-methylphenyl)-3,4,4-trimethylpentanamide.
| Compound Name | N-(2-carbamothioyl-3-methylphenyl)-3,4,4-trimethylpentanamide |
|---|---|
| PubChem CID | 107805667 |
| Molecular Formula | C16H24N2OS |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | N-(2-carbamothioyl-3-methylphenyl)-3,4,4-trimethylpentanamide |
| SMILES | Cc1cccc(NC(=O)CC(C)C(C)(C)C)c1C(N)=S |
| InChI | InChI=1S/C16H24N2OS/c1-10-7-6-8-12(14(10)15(17)20)18-13(19)9-11(2)16(3,4)5/h6-8,11H,9H2,1-5H3,(H2,17,20)(H,18,19) |
| InChIKey | HWCYAFPWIMIFHO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|